C21H26N2O3S — CID 110365415
(2-methylphenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone (PubChem CID 110365415) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is (2-methylphenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone.
| Compound Name | (2-methylphenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110365415 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2-methylphenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccccc1C(=O)N1CCN(S(=O)(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N2O3S/c1-18-8-5-6-12-20(18)21(24)22-13-15-23(16-14-22)27(25,26)17-7-11-19-9-3-2-4-10-19/h2-6,8-10,12H,7,11,13-17H2,1H3 |
| InChIKey | LQPVMLUOLUQVQL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |