C20H23FN2O3S — CID 110365284
(2-fluorophenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone (PubChem CID 110365284) has the molecular formula C20H23FN2O3S and a molecular weight of 390.48 g/mol. Its IUPAC name is (2-fluorophenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone.
| Compound Name | (2-fluorophenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110365284 |
| Molecular Formula | C20H23FN2O3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (2-fluorophenyl)-[4-(3-phenylpropylsulfonyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1F)N1CCN(S(=O)(=O)CCCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23FN2O3S/c21-19-11-5-4-10-18(19)20(24)22-12-14-23(15-13-22)27(25,26)16-6-9-17-7-2-1-3-8-17/h1-5,7-8,10-11H,6,9,12-16H2 |
| InChIKey | HMJIOENPSRINJC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |