C18H17ClN2O3 — CID 110366991
2-chloro-N-[(5-oxo-4-phenylmorpholin-2-yl)methyl]benzamide (PubChem CID 110366991) has the molecular formula C18H17ClN2O3 and a molecular weight of 344.80 g/mol. Its IUPAC name is 2-chloro-N-[(5-oxo-4-phenylmorpholin-2-yl)methyl]benzamide.
| Compound Name | 2-chloro-N-[(5-oxo-4-phenylmorpholin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110366991 |
| Molecular Formula | C18H17ClN2O3 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-chloro-N-[(5-oxo-4-phenylmorpholin-2-yl)methyl]benzamide |
| SMILES | O=C(NCC1CN(c2ccccc2)C(=O)CO1)c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN2O3/c19-16-9-5-4-8-15(16)18(23)20-10-14-11-21(17(22)12-24-14)13-6-2-1-3-7-13/h1-9,14H,10-12H2,(H,20,23) |
| InChIKey | YUBSLACODYRSNP-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |