C18H16ClFN2O3 — CID 110367477
N-[[4-(3-chlorophenyl)-5-oxomorpholin-2-yl]methyl]-2-fluorobenzamide (PubChem CID 110367477) has the molecular formula C18H16ClFN2O3 and a molecular weight of 362.79 g/mol. Its IUPAC name is N-[[4-(3-chlorophenyl)-5-oxomorpholin-2-yl]methyl]-2-fluorobenzamide.
| Compound Name | N-[[4-(3-chlorophenyl)-5-oxomorpholin-2-yl]methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 110367477 |
| Molecular Formula | C18H16ClFN2O3 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-[[4-(3-chlorophenyl)-5-oxomorpholin-2-yl]methyl]-2-fluorobenzamide |
| SMILES | O=C(NCC1CN(c2cccc(Cl)c2)C(=O)CO1)c1ccccc1F |
| InChI | InChI=1S/C18H16ClFN2O3/c19-12-4-3-5-13(8-12)22-10-14(25-11-17(22)23)9-21-18(24)15-6-1-2-7-16(15)20/h1-8,14H,9-11H2,(H,21,24) |
| InChIKey | VDOARJXSTAXVMX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |