C13H18FNO4S — CID 110370153
N-[2-(1,3-dioxan-2-yl)ethyl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 110370153) has the molecular formula C13H18FNO4S and a molecular weight of 303.35 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 110370153 |
| Molecular Formula | C13H18FNO4S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCCC1OCCCO1 |
| InChI | InChI=1S/C13H18FNO4S/c1-10-9-11(14)3-4-12(10)20(16,17)15-6-5-13-18-7-2-8-19-13/h3-4,9,13,15H,2,5-8H2,1H3 |
| InChIKey | JQPMZZQZQGGBQD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |