C17H15ClN4O — CID 110372973
1-(4-chlorophenyl)-5-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide (PubChem CID 110372973) has the molecular formula C17H15ClN4O and a molecular weight of 326.79 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-5-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110372973 |
| Molecular Formula | C17H15ClN4O |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 1-(4-chlorophenyl)-5-methyl-N-(pyridin-4-ylmethyl)pyrazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCc2ccncc2)nn1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN4O/c1-12-10-16(17(23)20-11-13-6-8-19-9-7-13)21-22(12)15-4-2-14(18)3-5-15/h2-10H,11H2,1H3,(H,20,23) |
| InChIKey | OHRURIZUJVZWGS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |