C21H19FN2O3 — CID 110373578
N-(2,4-dimethoxyphenyl)-2-(4-fluorophenyl)-2-pyridin-2-ylacetamide (PubChem CID 110373578) has the molecular formula C21H19FN2O3 and a molecular weight of 366.39 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2-(4-fluorophenyl)-2-pyridin-2-ylacetamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2-(4-fluorophenyl)-2-pyridin-2-ylacetamide |
|---|---|
| PubChem CID | 110373578 |
| Molecular Formula | C21H19FN2O3 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2-(4-fluorophenyl)-2-pyridin-2-ylacetamide |
| SMILES | COc1ccc(NC(=O)C(c2ccc(F)cc2)c2ccccn2)c(OC)c1 |
| InChI | InChI=1S/C21H19FN2O3/c1-26-16-10-11-17(19(13-16)27-2)24-21(25)20(18-5-3-4-12-23-18)14-6-8-15(22)9-7-14/h3-13,20H,1-2H3,(H,24,25) |
| InChIKey | NXWVUJACWIETNP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |