C23H15ClF3N3OS — CID 11038070
(4Z)-4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-one (PubChem CID 11038070) has the molecular formula C23H15ClF3N3OS and a molecular weight of 473.91 g/mol. Its IUPAC name is (4Z)-4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-one.
| Compound Name | (4Z)-4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-one |
|---|---|
| PubChem CID | 11038070 |
| Molecular Formula | C23H15ClF3N3OS |
| Molecular Weight | 473.91 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | (4Z)-4-[[4-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazinylidene]-1,1,1-trifluoro-4-naphthalen-2-ylbutan-2-one |
| SMILES | O=C(C/C(=N/Nc1nc(-c2ccc(Cl)cc2)cs1)c1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C23H15ClF3N3OS/c24-18-9-7-15(8-10-18)20-13-32-22(28-20)30-29-19(12-21(31)23(25,26)27)17-6-5-14-3-1-2-4-16(14)11-17/h1-11,13H,12H2,(H,28,30)/b29-19- |
| InChIKey | LJTLCICRSJYZMM-CEUNXORHSA-N |
| XLogP | 6.95 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.91 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|