C33H35NO2 — CID 11038131
11-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methyl-12-nitro-6-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),12-hexaene (PubChem CID 11038131) has the molecular formula C33H35NO2 and a molecular weight of 477.65 g/mol. Its IUPAC name is 11-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methyl-12-nitro-6-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),12-hexaene.
| Compound Name | 11-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methyl-12-nitro-6-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),12-hexaene |
|---|---|
| PubChem CID | 11038131 |
| Molecular Formula | C33H35NO2 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 11-(3,8-dimethyl-5-propan-2-ylazulen-1-yl)-3-methyl-12-nitro-6-propan-2-yltricyclo[7.4.1.04,14]tetradeca-1,3,5,7,9(14),12-hexaene |
| SMILES | Cc1cc2c3c(ccc(C(C)C)cc1-3)CC(c1cc(C)c3cc(C(C)C)ccc(C)c1-3)C([N+](=O)[O-])=C2 |
| InChI | InChI=1S/C33H35NO2/c1-18(2)23-9-8-20(5)32-27(14-23)22(7)13-30(32)29-16-25-11-10-24(19(3)4)15-28-21(6)12-26(33(25)28)17-31(29)34(35)36/h8-15,17-19,29H,16H2,1-7H3 |
| InChIKey | ANVPCEBBYFXNHV-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|