C20H17N3O6 — CID 110381928
1-[(3-methoxyphenyl)methoxy]-N-(2-nitrophenyl)-2-oxopyridine-3-carboxamide (PubChem CID 110381928) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methoxy]-N-(2-nitrophenyl)-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[(3-methoxyphenyl)methoxy]-N-(2-nitrophenyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110381928 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 1-[(3-methoxyphenyl)methoxy]-N-(2-nitrophenyl)-2-oxopyridine-3-carboxamide |
| SMILES | COc1cccc(COn2cccc(C(=O)Nc3ccccc3[N+](=O)[O-])c2=O)c1 |
| InChI | InChI=1S/C20H17N3O6/c1-28-15-7-4-6-14(12-15)13-29-22-11-5-8-16(20(22)25)19(24)21-17-9-2-3-10-18(17)23(26)27/h2-12H,13H2,1H3,(H,21,24) |
| InChIKey | LQOAVRYJYZVRBN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|