C20H14ClN3O3 — CID 110382844
1-[(3-chlorophenyl)methoxy]-N-(2-cyanophenyl)-2-oxopyridine-3-carboxamide (PubChem CID 110382844) has the molecular formula C20H14ClN3O3 and a molecular weight of 379.80 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methoxy]-N-(2-cyanophenyl)-2-oxopyridine-3-carboxamide.
| Compound Name | 1-[(3-chlorophenyl)methoxy]-N-(2-cyanophenyl)-2-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 110382844 |
| Molecular Formula | C20H14ClN3O3 |
| Molecular Weight | 379.80 g/mol |
| Exact Mass | 379.07 |
| IUPAC Name | 1-[(3-chlorophenyl)methoxy]-N-(2-cyanophenyl)-2-oxopyridine-3-carboxamide |
| SMILES | N#Cc1ccccc1NC(=O)c1cccn(OCc2cccc(Cl)c2)c1=O |
| InChI | InChI=1S/C20H14ClN3O3/c21-16-7-3-5-14(11-16)13-27-24-10-4-8-17(20(24)26)19(25)23-18-9-2-1-6-15(18)12-22/h1-11H,13H2,(H,23,25) |
| InChIKey | HGEACPHPFCONEG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.80 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |