C12H9N5O3S — CID 110384607
N-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide (PubChem CID 110384607) has the molecular formula C12H9N5O3S and a molecular weight of 303.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 110384607 |
| Molecular Formula | C12H9N5O3S |
| Molecular Weight | 303.30 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)OCO2)c1nn2cnnc2s1 |
| InChI | InChI=1S/C12H9N5O3S/c18-10(11-16-17-5-14-15-12(17)21-11)13-4-7-1-2-8-9(3-7)20-6-19-8/h1-3,5H,4,6H2,(H,13,18) |
| InChIKey | AZOJCRDBGXKZHI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |