C30H54O4Si — CID 11038486
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(cyclopenten-1-yl)-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]acetate (PubChem CID 11038486) has the molecular formula C30H54O4Si and a molecular weight of 506.84 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(cyclopenten-1-yl)-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(cyclopenten-1-yl)-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]acetate |
|---|---|
| PubChem CID | 11038486 |
| Molecular Formula | C30H54O4Si |
| Molecular Weight | 506.84 g/mol |
| Exact Mass | 506.38 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-(cyclopenten-1-yl)-2-[(Z)-4-tri(propan-2-yl)silyloxybut-2-enoxy]acetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)C(OC/C=C\CO[Si](C(C)C)(C(C)C)C(C)C)C1=CCCC1 |
| InChI | InChI=1S/C30H54O4Si/c1-21(2)27-17-16-25(9)20-28(27)34-30(31)29(26-14-10-11-15-26)32-18-12-13-19-33-35(22(3)4,23(5)6)24(7)8/h12-14,21-25,27-29H,10-11,15-20H2,1-9H3/b13-12-/t25-,27+,28-,29?/m1/s1 |
| InChIKey | HWOUVJIZQATRQU-FIKDOTEZSA-N |
| XLogP | 8.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.84 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|