C25H42O4 — CID 91422864
2-cyclohexyloxypent-3-enoyl 2,6,10-trimethylundec-9-enoate (PubChem CID 91422864) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is 2-cyclohexyloxypent-3-enoyl 2,6,10-trimethylundec-9-enoate.
| Compound Name | 2-cyclohexyloxypent-3-enoyl 2,6,10-trimethylundec-9-enoate |
|---|---|
| PubChem CID | 91422864 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | 2-cyclohexyloxypent-3-enoyl 2,6,10-trimethylundec-9-enoate |
| SMILES | CC=CC(OC1CCCCC1)C(=O)OC(=O)C(C)CCCC(C)CCC=C(C)C |
| InChI | InChI=1S/C25H42O4/c1-6-12-23(28-22-17-8-7-9-18-22)25(27)29-24(26)21(5)16-11-15-20(4)14-10-13-19(2)3/h6,12-13,20-23H,7-11,14-18H2,1-5H3 |
| InChIKey | JIFMECWXAGVGKQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|