C31H50O4 — CID 15024570
[(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (Z)-octadec-9-enoate (PubChem CID 15024570) has the molecular formula C31H50O4 and a molecular weight of 486.74 g/mol. Its IUPAC name is [(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (Z)-octadec-9-enoate.
| Compound Name | [(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 15024570 |
| Molecular Formula | C31H50O4 |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | [(2S,6R)-6-(2-methylcyclohex-2-en-1-yl)-5-oxo-2H-pyran-2-yl]methyl (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H]1C=CC(=O)[C@@H](C2CCCC=C2C)O1 |
| InChI | InChI=1S/C31H50O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-30(33)34-25-27-23-24-29(32)31(35-27)28-21-19-18-20-26(28)2/h10-11,20,23-24,27-28,31H,3-9,12-19,21-22,25H2,1-2H3/b11-10-/t27-,28?,31+/m0/s1 |
| InChIKey | BWMNGJYZFMIDLX-MFDMDKGPSA-N |
| XLogP | 8.21 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|