C9H10F3N5OS — CID 110385034
N,N-diethyl-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide (PubChem CID 110385034) has the molecular formula C9H10F3N5OS and a molecular weight of 293.27 g/mol. Its IUPAC name is N,N-diethyl-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide.
| Compound Name | N,N-diethyl-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
|---|---|
| PubChem CID | 110385034 |
| Molecular Formula | C9H10F3N5OS |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | N,N-diethyl-3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-6-carboxamide |
| SMILES | CCN(CC)C(=O)c1nn2c(C(F)(F)F)nnc2s1 |
| InChI | InChI=1S/C9H10F3N5OS/c1-3-16(4-2)6(18)5-15-17-7(9(10,11)12)13-14-8(17)19-5/h3-4H2,1-2H3 |
| InChIKey | ADXLBYDVFCSHSU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |