C9H11F3N6OS — CID 110401897
1,1-dimethyl-3-[2-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]ethyl]urea (PubChem CID 110401897) has the molecular formula C9H11F3N6OS and a molecular weight of 308.29 g/mol. Its IUPAC name is 1,1-dimethyl-3-[2-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]ethyl]urea.
| Compound Name | 1,1-dimethyl-3-[2-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]ethyl]urea |
|---|---|
| PubChem CID | 110401897 |
| Molecular Formula | C9H11F3N6OS |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | 1,1-dimethyl-3-[2-[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]ethyl]urea |
| SMILES | CN(C)C(=O)NCCc1nn2c(C(F)(F)F)nnc2s1 |
| InChI | InChI=1S/C9H11F3N6OS/c1-17(2)7(19)13-4-3-5-16-18-6(9(10,11)12)14-15-8(18)20-5/h3-4H2,1-2H3,(H,13,19) |
| InChIKey | NJKGDJXQPZHEGP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |