C14H22N2OS — CID 110388540
N-butyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide (PubChem CID 110388540) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is N-butyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | N-butyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 110388540 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | N-butyl-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propanamide |
| SMILES | CCCCNC(=O)CCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H22N2OS/c1-2-3-10-15-13(17)8-9-14-16-11-6-4-5-7-12(11)18-14/h2-10H2,1H3,(H,15,17) |
| InChIKey | MYIWSEKDZQFNNX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|