C14H20N2OS — CID 110459785
(E)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]but-2-enamide (PubChem CID 110459785) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is (E)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]but-2-enamide.
| Compound Name | (E)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]but-2-enamide |
|---|---|
| PubChem CID | 110459785 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (E)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]but-2-enamide |
| SMILES | C/C=C/C(=O)NCCCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H20N2OS/c1-2-6-13(17)15-10-5-9-14-16-11-7-3-4-8-12(11)18-14/h2,6H,3-5,7-10H2,1H3,(H,15,17)/b6-2+ |
| InChIKey | LMSCFTVDVQMOPI-QHHAFSJGSA-N |
| XLogP | 2.65 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|