C15H18N2OS2 — CID 110442389
N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]thiophene-2-carboxamide (PubChem CID 110442389) has the molecular formula C15H18N2OS2 and a molecular weight of 306.46 g/mol. Its IUPAC name is N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 110442389 |
| Molecular Formula | C15H18N2OS2 |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]thiophene-2-carboxamide |
| SMILES | O=C(NCCCc1nc2c(s1)CCCC2)c1cccs1 |
| InChI | InChI=1S/C15H18N2OS2/c18-15(13-7-4-10-19-13)16-9-3-8-14-17-11-5-1-2-6-12(11)20-14/h4,7,10H,1-3,5-6,8-9H2,(H,16,18) |
| InChIKey | KRONZJZODHUETQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|