C17H27N3O2S — CID 99833380
1-[(1R,3S)-3-methoxycyclopentyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]urea (PubChem CID 99833380) has the molecular formula C17H27N3O2S and a molecular weight of 337.49 g/mol. Its IUPAC name is 1-[(1R,3S)-3-methoxycyclopentyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]urea.
| Compound Name | 1-[(1R,3S)-3-methoxycyclopentyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 99833380 |
| Molecular Formula | C17H27N3O2S |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 1-[(1R,3S)-3-methoxycyclopentyl]-3-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]urea |
| SMILES | CO[C@H]1CC[C@@H](NC(=O)NCCCc2nc3c(s2)CCCC3)C1 |
| InChI | InChI=1S/C17H27N3O2S/c1-22-13-9-8-12(11-13)19-17(21)18-10-4-7-16-20-14-5-2-3-6-15(14)23-16/h12-13H,2-11H2,1H3,(H2,18,19,21)/t12-,13+/m1/s1 |
| InChIKey | SJEJWGTZSLFCNN-OLZOCXBDSA-N |
| XLogP | 2.82 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|