C16H26ClN3OS — CID 119316773
N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-2-carboxamide;hydrochloride (PubChem CID 119316773) has the molecular formula C16H26ClN3OS and a molecular weight of 343.92 g/mol. Its IUPAC name is N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-2-carboxamide;hydrochloride.
| Compound Name | N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119316773 |
| Molecular Formula | C16H26ClN3OS |
| Molecular Weight | 343.92 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]piperidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NCCCc1nc2c(s1)CCCC2)C1CCCCN1 |
| InChI | InChI=1S/C16H25N3OS.ClH/c20-16(13-7-3-4-10-17-13)18-11-5-9-15-19-12-6-1-2-8-14(12)21-15;/h13,17H,1-11H2,(H,18,20);1H |
| InChIKey | CCNAHFXEZPUVBL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.92 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|