C15H23N3O2S — CID 124702973
(3S)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]morpholine-3-carboxamide (PubChem CID 124702973) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is (3S)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]morpholine-3-carboxamide.
| Compound Name | (3S)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 124702973 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (3S)-N-[3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)propyl]morpholine-3-carboxamide |
| SMILES | O=C(NCCCc1nc2c(s1)CCCC2)[C@@H]1COCCN1 |
| InChI | InChI=1S/C15H23N3O2S/c19-15(12-10-20-9-8-16-12)17-7-3-6-14-18-11-4-1-2-5-13(11)21-14/h12,16H,1-10H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | GXNXDFZKYARRMP-LBPRGKRZSA-N |
| XLogP | 1.06 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|