C36H44N4O — CID 11038912
(2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-(5-ethyl-1-tritylimidazol-4-yl)pentan-1-one (PubChem CID 11038912) has the molecular formula C36H44N4O and a molecular weight of 548.78 g/mol. Its IUPAC name is (2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-(5-ethyl-1-tritylimidazol-4-yl)pentan-1-one.
| Compound Name | (2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-(5-ethyl-1-tritylimidazol-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 11038912 |
| Molecular Formula | C36H44N4O |
| Molecular Weight | 548.78 g/mol |
| Exact Mass | 548.35 |
| IUPAC Name | (2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-(5-ethyl-1-tritylimidazol-4-yl)pentan-1-one |
| SMILES | CCc1c(CCC[C@H](N)C(=O)N2CCC(CC)CC2)ncn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H44N4O/c1-3-28-23-25-39(26-24-28)35(41)32(37)21-14-22-33-34(4-2)40(27-38-33)36(29-15-8-5-9-16-29,30-17-10-6-11-18-30)31-19-12-7-13-20-31/h5-13,15-20,27-28,32H,3-4,14,21-26,37H2,1-2H3/t32-/m0/s1 |
| InChIKey | AWAXCUKWLHUNQN-YTTGMZPUSA-N |
| XLogP | 6.58 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.78 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|