C24H40ClN3O — CID 159824883
(2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-piperidin-4-ylpentan-1-one;chloromethylbenzene (PubChem CID 159824883) has the molecular formula C24H40ClN3O and a molecular weight of 422.06 g/mol. Its IUPAC name is (2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-piperidin-4-ylpentan-1-one;chloromethylbenzene.
| Compound Name | (2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-piperidin-4-ylpentan-1-one;chloromethylbenzene |
|---|---|
| PubChem CID | 159824883 |
| Molecular Formula | C24H40ClN3O |
| Molecular Weight | 422.06 g/mol |
| Exact Mass | 421.29 |
| IUPAC Name | (2S)-2-amino-1-(4-ethylpiperidin-1-yl)-5-piperidin-4-ylpentan-1-one;chloromethylbenzene |
| SMILES | CCC1CCN(C(=O)[C@@H](N)CCCC2CCNCC2)CC1.ClCc1ccccc1 |
| InChI | InChI=1S/C17H33N3O.C7H7Cl/c1-2-14-8-12-20(13-9-14)17(21)16(18)5-3-4-15-6-10-19-11-7-15;8-6-7-4-2-1-3-5-7/h14-16,19H,2-13,18H2,1H3;1-5H,6H2/t16-;/m0./s1 |
| InChIKey | NMSBMLCSNDGMLB-NTISSMGPSA-N |
| XLogP | 4.56 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.06 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|