C32H41N3O3 — CID 11606990
1-[4-[3-[1-[(2S)-2-aminopentanoyl]piperidin-4-yl]propyl]piperidin-1-yl]anthracene-9,10-dione (PubChem CID 11606990) has the molecular formula C32H41N3O3 and a molecular weight of 515.70 g/mol. Its IUPAC name is 1-[4-[3-[1-[(2S)-2-aminopentanoyl]piperidin-4-yl]propyl]piperidin-1-yl]anthracene-9,10-dione.
| Compound Name | 1-[4-[3-[1-[(2S)-2-aminopentanoyl]piperidin-4-yl]propyl]piperidin-1-yl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 11606990 |
| Molecular Formula | C32H41N3O3 |
| Molecular Weight | 515.70 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | 1-[4-[3-[1-[(2S)-2-aminopentanoyl]piperidin-4-yl]propyl]piperidin-1-yl]anthracene-9,10-dione |
| SMILES | CCC[C@H](N)C(=O)N1CCC(CCCC2CCN(c3cccc4c3C(=O)c3ccccc3C4=O)CC2)CC1 |
| InChI | InChI=1S/C32H41N3O3/c1-2-7-27(33)32(38)35-20-16-23(17-21-35)9-5-8-22-14-18-34(19-15-22)28-13-6-12-26-29(28)31(37)25-11-4-3-10-24(25)30(26)36/h3-4,6,10-13,22-23,27H,2,5,7-9,14-21,33H2,1H3/t27-/m0/s1 |
| InChIKey | UYUMNBNGCHPTQQ-MHZLTWQESA-N |
| XLogP | 5.21 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.70 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|