C22H33N5O5 — CID 57158383
benzyl N-[amino-[[4-amino-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]carbamoyloxy]methylidene]carbamate (PubChem CID 57158383) has the molecular formula C22H33N5O5 and a molecular weight of 447.54 g/mol. Its IUPAC name is benzyl N-[amino-[[4-amino-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]carbamoyloxy]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[[4-amino-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]carbamoyloxy]methylidene]carbamate |
|---|---|
| PubChem CID | 57158383 |
| Molecular Formula | C22H33N5O5 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | benzyl N-[amino-[[4-amino-5-(4-ethylpiperidin-1-yl)-5-oxopentyl]carbamoyloxy]methylidene]carbamate |
| SMILES | CCC1CCN(C(=O)C(N)CCCNC(=O)OC(N)=NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H33N5O5/c1-2-16-10-13-27(14-11-16)19(28)18(23)9-6-12-25-21(29)32-20(24)26-22(30)31-15-17-7-4-3-5-8-17/h3-5,7-8,16,18H,2,6,9-15,23H2,1H3,(H,25,29)(H2,24,26,30) |
| InChIKey | ZGMRGOFSXMSHOY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|