C15H22N4O2 — CID 11130036
benzyl (NE)-N-[amino-[4-(aminomethyl)piperidin-1-yl]methylidene]carbamate (PubChem CID 11130036) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is benzyl (NE)-N-[amino-[4-(aminomethyl)piperidin-1-yl]methylidene]carbamate.
| Compound Name | benzyl (NE)-N-[amino-[4-(aminomethyl)piperidin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 11130036 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | benzyl (NE)-N-[amino-[4-(aminomethyl)piperidin-1-yl]methylidene]carbamate |
| SMILES | NCC1CCN(/C(N)=N/C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C15H22N4O2/c16-10-12-6-8-19(9-7-12)14(17)18-15(20)21-11-13-4-2-1-3-5-13/h1-5,12H,6-11,16H2,(H2,17,18,20) |
| InChIKey | DPYMTGLUMLGWDO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|