C14H21N5O2 — CID 174446880
benzyl N-[amino-[4-(aminomethyl)piperazin-1-yl]methylidene]carbamate (PubChem CID 174446880) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is benzyl N-[amino-[4-(aminomethyl)piperazin-1-yl]methylidene]carbamate.
| Compound Name | benzyl N-[amino-[4-(aminomethyl)piperazin-1-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 174446880 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | benzyl N-[amino-[4-(aminomethyl)piperazin-1-yl]methylidene]carbamate |
| SMILES | NCN1CCN(C(N)=NC(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C14H21N5O2/c15-11-18-6-8-19(9-7-18)13(16)17-14(20)21-10-12-4-2-1-3-5-12/h1-5H,6-11,15H2,(H2,16,17,20) |
| InChIKey | RRAHLAFZDBJVFU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 97.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|