C15H22N2O4 — CID 166610780
benzyl 4-(2,3-dihydroxypropyl)piperazine-1-carboxylate (PubChem CID 166610780) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is benzyl 4-(2,3-dihydroxypropyl)piperazine-1-carboxylate.
| Compound Name | benzyl 4-(2,3-dihydroxypropyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166610780 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | benzyl 4-(2,3-dihydroxypropyl)piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCN(CC(O)CO)CC1 |
| InChI | InChI=1S/C15H22N2O4/c18-11-14(19)10-16-6-8-17(9-7-16)15(20)21-12-13-4-2-1-3-5-13/h1-5,14,18-19H,6-12H2 |
| InChIKey | HLAWREPEFUASCJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 73.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |