C21H21FN2O2 — CID 110389986
N-[2-(4-fluorophenyl)ethyl]-3-(3-methyl-2-oxo-1H-quinolin-7-yl)propanamide (PubChem CID 110389986) has the molecular formula C21H21FN2O2 and a molecular weight of 352.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-3-(3-methyl-2-oxo-1H-quinolin-7-yl)propanamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-3-(3-methyl-2-oxo-1H-quinolin-7-yl)propanamide |
|---|---|
| PubChem CID | 110389986 |
| Molecular Formula | C21H21FN2O2 |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-3-(3-methyl-2-oxo-1H-quinolin-7-yl)propanamide |
| SMILES | Cc1cc2ccc(CCC(=O)NCCc3ccc(F)cc3)cc2[nH]c1=O |
| InChI | InChI=1S/C21H21FN2O2/c1-14-12-17-6-2-16(13-19(17)24-21(14)26)5-9-20(25)23-11-10-15-3-7-18(22)8-4-15/h2-4,6-8,12-13H,5,9-11H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | XPMRAZJXCJDJNL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |