C20H20N4O3 — CID 110391990
5-(3-methoxyphenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110391990) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-(3-methoxyphenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110391990 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5-(3-methoxyphenyl)-N-(4-pyrrolidin-1-ylphenyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COc1cccc(-c2nnc(C(=O)Nc3ccc(N4CCCC4)cc3)o2)c1 |
| InChI | InChI=1S/C20H20N4O3/c1-26-17-6-4-5-14(13-17)19-22-23-20(27-19)18(25)21-15-7-9-16(10-8-15)24-11-2-3-12-24/h4-10,13H,2-3,11-12H2,1H3,(H,21,25) |
| InChIKey | AHBQYDMBUZGHNJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|