C21H23N5O2 — CID 110393326
5-benzyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110393326) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 5-benzyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-benzyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110393326 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 5-benzyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3nnc(Cc4ccccc4)o3)cc2)CC1 |
| InChI | InChI=1S/C21H23N5O2/c1-25-11-13-26(14-12-25)18-9-7-17(8-10-18)22-20(27)21-24-23-19(28-21)15-16-5-3-2-4-6-16/h2-10H,11-15H2,1H3,(H,22,27) |
| InChIKey | LTBCYRHWBAARIW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|