C16H11F2N3O2 — CID 110393360
5-benzyl-N-(2,6-difluorophenyl)-1,3,4-oxadiazole-2-carboxamide (PubChem CID 110393360) has the molecular formula C16H11F2N3O2 and a molecular weight of 315.28 g/mol. Its IUPAC name is 5-benzyl-N-(2,6-difluorophenyl)-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-benzyl-N-(2,6-difluorophenyl)-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 110393360 |
| Molecular Formula | C16H11F2N3O2 |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 5-benzyl-N-(2,6-difluorophenyl)-1,3,4-oxadiazole-2-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)c1nnc(Cc2ccccc2)o1 |
| InChI | InChI=1S/C16H11F2N3O2/c17-11-7-4-8-12(18)14(11)19-15(22)16-21-20-13(23-16)9-10-5-2-1-3-6-10/h1-8H,9H2,(H,19,22) |
| InChIKey | QGMGPEUDIYLLFP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |