C19H17N3O4 — CID 110393338
ethyl 4-[(5-benzyl-1,3,4-oxadiazole-2-carbonyl)amino]benzoate (PubChem CID 110393338) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is ethyl 4-[(5-benzyl-1,3,4-oxadiazole-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(5-benzyl-1,3,4-oxadiazole-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 110393338 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | ethyl 4-[(5-benzyl-1,3,4-oxadiazole-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2nnc(Cc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-2-25-19(24)14-8-10-15(11-9-14)20-17(23)18-22-21-16(26-18)12-13-6-4-3-5-7-13/h3-11H,2,12H2,1H3,(H,20,23) |
| InChIKey | KPHUYAGITKXRKT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |