C33H68O8Si3 — CID 11039683
ethyl (4R)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate (PubChem CID 11039683) has the molecular formula C33H68O8Si3 and a molecular weight of 677.16 g/mol. Its IUPAC name is ethyl (4R)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate.
| Compound Name | ethyl (4R)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 11039683 |
| Molecular Formula | C33H68O8Si3 |
| Molecular Weight | 677.16 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | ethyl (4R)-4-[(4R,5R)-2,2-dimethyl-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]-1,3-dioxolan-4-yl]-4-hydroxy-2-methylidenebutanoate |
| SMILES | C=C(C[C@@H](O)[C@H]1OC(C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C33H68O8Si3/c1-20-36-29(35)23(2)21-24(34)26-28(39-33(12,13)38-26)27(41-44(18,19)32(9,10)11)25(40-43(16,17)31(6,7)8)22-37-42(14,15)30(3,4)5/h24-28,34H,2,20-22H2,1,3-19H3/t24-,25-,26-,27-,28-/m1/s1 |
| InChIKey | WEMSLTHZRWGKEY-JQPIIJRMSA-N |
| XLogP | 8.18 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.16 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|