C14H21N3O4S — CID 110397608
phenyl N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]carbamate (PubChem CID 110397608) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is phenyl N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]carbamate.
| Compound Name | phenyl N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 110397608 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | phenyl N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]carbamate |
| SMILES | CS(=O)(=O)N1CCN(CCNC(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C14H21N3O4S/c1-22(19,20)17-11-9-16(10-12-17)8-7-15-14(18)21-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H,15,18) |
| InChIKey | BEDSMGIYYPYMIN-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |