C16H22N4O4S — CID 51126659
2-(4-cyanophenoxy)-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]acetamide (PubChem CID 51126659) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is 2-(4-cyanophenoxy)-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]acetamide.
| Compound Name | 2-(4-cyanophenoxy)-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 51126659 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(4-cyanophenoxy)-N-[2-(4-methylsulfonylpiperazin-1-yl)ethyl]acetamide |
| SMILES | CS(=O)(=O)N1CCN(CCNC(=O)COc2ccc(C#N)cc2)CC1 |
| InChI | InChI=1S/C16H22N4O4S/c1-25(22,23)20-10-8-19(9-11-20)7-6-18-16(21)13-24-15-4-2-14(12-17)3-5-15/h2-5H,6-11,13H2,1H3,(H,18,21) |
| InChIKey | PGIMKYGAXQVWDQ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |