C16H20N2O6S — CID 110398487
N-[2-(1,3-dioxan-2-yl)ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide (PubChem CID 110398487) has the molecular formula C16H20N2O6S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide.
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 110398487 |
| Molecular Formula | C16H20N2O6S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]-4-(2,5-dioxopyrrolidin-1-yl)benzenesulfonamide |
| SMILES | O=C1CCC(=O)N1c1ccc(S(=O)(=O)NCCC2OCCCO2)cc1 |
| InChI | InChI=1S/C16H20N2O6S/c19-14-6-7-15(20)18(14)12-2-4-13(5-3-12)25(21,22)17-9-8-16-23-10-1-11-24-16/h2-5,16-17H,1,6-11H2 |
| InChIKey | RBKPECFVRWYPSX-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|