C16H21N3O5S — CID 110400173
6-(4-butylsulfonylpiperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one (PubChem CID 110400173) has the molecular formula C16H21N3O5S and a molecular weight of 367.43 g/mol. Its IUPAC name is 6-(4-butylsulfonylpiperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(4-butylsulfonylpiperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 110400173 |
| Molecular Formula | C16H21N3O5S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 6-(4-butylsulfonylpiperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one |
| SMILES | CCCCS(=O)(=O)N1CCN(C(=O)c2ccc3[nH]c(=O)oc3c2)CC1 |
| InChI | InChI=1S/C16H21N3O5S/c1-2-3-10-25(22,23)19-8-6-18(7-9-19)15(20)12-4-5-13-14(11-12)24-16(21)17-13/h4-5,11H,2-3,6-10H2,1H3,(H,17,21) |
| InChIKey | XZLHWUOROWKDQK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 103.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |