C19H26N4O3S — CID 108569305
(4-butylsulfonylpiperazin-1-yl)-(2,3-dimethylquinoxalin-6-yl)methanone (PubChem CID 108569305) has the molecular formula C19H26N4O3S and a molecular weight of 390.51 g/mol. Its IUPAC name is (4-butylsulfonylpiperazin-1-yl)-(2,3-dimethylquinoxalin-6-yl)methanone.
| Compound Name | (4-butylsulfonylpiperazin-1-yl)-(2,3-dimethylquinoxalin-6-yl)methanone |
|---|---|
| PubChem CID | 108569305 |
| Molecular Formula | C19H26N4O3S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | (4-butylsulfonylpiperazin-1-yl)-(2,3-dimethylquinoxalin-6-yl)methanone |
| SMILES | CCCCS(=O)(=O)N1CCN(C(=O)c2ccc3nc(C)c(C)nc3c2)CC1 |
| InChI | InChI=1S/C19H26N4O3S/c1-4-5-12-27(25,26)23-10-8-22(9-11-23)19(24)16-6-7-17-18(13-16)21-15(3)14(2)20-17/h6-7,13H,4-5,8-12H2,1-3H3 |
| InChIKey | AJLZDWWYBRUOIT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |