C13H11Cl2N5O2S — CID 110401107
3,6-dichloro-2-methoxy-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]benzamide (PubChem CID 110401107) has the molecular formula C13H11Cl2N5O2S and a molecular weight of 372.24 g/mol. Its IUPAC name is 3,6-dichloro-2-methoxy-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]benzamide.
| Compound Name | 3,6-dichloro-2-methoxy-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]benzamide |
|---|---|
| PubChem CID | 110401107 |
| Molecular Formula | C13H11Cl2N5O2S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 3,6-dichloro-2-methoxy-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]benzamide |
| SMILES | COc1c(Cl)ccc(Cl)c1C(=O)NCc1nn2c(C)nnc2s1 |
| InChI | InChI=1S/C13H11Cl2N5O2S/c1-6-17-18-13-20(6)19-9(23-13)5-16-12(21)10-7(14)3-4-8(15)11(10)22-2/h3-4H,5H2,1-2H3,(H,16,21) |
| InChIKey | QMLSAGLCWWWHNJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |