C15H16N6O3S2 — CID 110401180
1-acetyl-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,3-dihydroindole-5-sulfonamide (PubChem CID 110401180) has the molecular formula C15H16N6O3S2 and a molecular weight of 392.47 g/mol. Its IUPAC name is 1-acetyl-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 110401180 |
| Molecular Formula | C15H16N6O3S2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-acetyl-N-[(3-methyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)NCc3nn4c(C)nnc4s3)ccc21 |
| InChI | InChI=1S/C15H16N6O3S2/c1-9-17-18-15-21(9)19-14(25-15)8-16-26(23,24)12-3-4-13-11(7-12)5-6-20(13)10(2)22/h3-4,7,16H,5-6,8H2,1-2H3 |
| InChIKey | QDNYTJYKMVSZQG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |