C13H12N6O4S2 — CID 110401484
N-[(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-3-nitrobenzenesulfonamide (PubChem CID 110401484) has the molecular formula C13H12N6O4S2 and a molecular weight of 380.41 g/mol. Its IUPAC name is N-[(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110401484 |
| Molecular Formula | C13H12N6O4S2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | N-[(3-cyclopropyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)NCc2nn3c(C4CC4)nnc3s2)c1 |
| InChI | InChI=1S/C13H12N6O4S2/c20-19(21)9-2-1-3-10(6-9)25(22,23)14-7-11-17-18-12(8-4-5-8)15-16-13(18)24-11/h1-3,6,8,14H,4-5,7H2 |
| InChIKey | IUXXROVYFPIWQX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|