C13H12F3N5O2S2 — CID 110402011
2,4-dimethyl-N-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]benzenesulfonamide (PubChem CID 110402011) has the molecular formula C13H12F3N5O2S2 and a molecular weight of 391.40 g/mol. Its IUPAC name is 2,4-dimethyl-N-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]benzenesulfonamide.
| Compound Name | 2,4-dimethyl-N-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110402011 |
| Molecular Formula | C13H12F3N5O2S2 |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.04 |
| IUPAC Name | 2,4-dimethyl-N-[[3-(trifluoromethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2nn3c(C(F)(F)F)nnc3s2)c(C)c1 |
| InChI | InChI=1S/C13H12F3N5O2S2/c1-7-3-4-9(8(2)5-7)25(22,23)17-6-10-20-21-11(13(14,15)16)18-19-12(21)24-10/h3-5,17H,6H2,1-2H3 |
| InChIKey | SSQQMVDIWUCGLC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |