C12H13N5O2S2 — CID 110401777
2,5-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzenesulfonamide (PubChem CID 110401777) has the molecular formula C12H13N5O2S2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2,5-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzenesulfonamide.
| Compound Name | 2,5-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110401777 |
| Molecular Formula | C12H13N5O2S2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2,5-dimethyl-N-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-ylmethyl)benzenesulfonamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCc2nn3cnnc3s2)c1 |
| InChI | InChI=1S/C12H13N5O2S2/c1-8-3-4-9(2)10(5-8)21(18,19)14-6-11-16-17-7-13-15-12(17)20-11/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | KPLAWEXOPUCOFA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |