C13H15N5O2S2 — CID 110401598
3,4-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide (PubChem CID 110401598) has the molecular formula C13H15N5O2S2 and a molecular weight of 337.43 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110401598 |
| Molecular Formula | C13H15N5O2S2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3,4-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCc2nn3cnnc3s2)cc1C |
| InChI | InChI=1S/C13H15N5O2S2/c1-9-3-4-11(7-10(9)2)22(19,20)15-6-5-12-17-18-8-14-16-13(18)21-12/h3-4,7-8,15H,5-6H2,1-2H3 |
| InChIKey | IVPIHRLLYZXTKE-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |