C15H19N5O3S2 — CID 110401639
4-ethoxy-2,5-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide (PubChem CID 110401639) has the molecular formula C15H19N5O3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-ethoxy-2,5-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-ethoxy-2,5-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110401639 |
| Molecular Formula | C15H19N5O3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 4-ethoxy-2,5-dimethyl-N-[2-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)ethyl]benzenesulfonamide |
| SMILES | CCOc1cc(C)c(S(=O)(=O)NCCc2nn3cnnc3s2)cc1C |
| InChI | InChI=1S/C15H19N5O3S2/c1-4-23-12-7-11(3)13(8-10(12)2)25(21,22)17-6-5-14-19-20-9-16-18-15(20)24-14/h7-9,17H,4-6H2,1-3H3 |
| InChIKey | GTOWUCSOCRPPMQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |