C15H10ClN3O5S — CID 110402617
N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-nitrobenzenesulfonamide (PubChem CID 110402617) has the molecular formula C15H10ClN3O5S and a molecular weight of 379.78 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 110402617 |
| Molecular Formula | C15H10ClN3O5S |
| Molecular Weight | 379.78 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | N-[4-(4-chlorophenyl)-1,2-oxazol-5-yl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2oncc2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H10ClN3O5S/c16-11-6-4-10(5-7-11)14-9-17-24-15(14)18-25(22,23)13-3-1-2-12(8-13)19(20)21/h1-9,18H |
| InChIKey | NWHOXCHCJFABKP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 115.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|