C18H16ClN3O4 — CID 110402667
1-(3-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]urea (PubChem CID 110402667) has the molecular formula C18H16ClN3O4 and a molecular weight of 373.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]urea |
|---|---|
| PubChem CID | 110402667 |
| Molecular Formula | C18H16ClN3O4 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[4-(3,4-dimethoxyphenyl)-1,2-oxazol-5-yl]urea |
| SMILES | COc1ccc(-c2cnoc2NC(=O)Nc2cccc(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H16ClN3O4/c1-24-15-7-6-11(8-16(15)25-2)14-10-20-26-17(14)22-18(23)21-13-5-3-4-12(19)9-13/h3-10H,1-2H3,(H2,21,22,23) |
| InChIKey | LGOIQMPXOQELRN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 85.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |